C27H37F3N4O4 — CID 58305908
[(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-(oxolan-3-yl)cyclopentyl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone (PubChem CID 58305908) has the molecular formula C27H37F3N4O4 and a molecular weight of 538.61 g/mol. Its IUPAC name is [(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-(oxolan-3-yl)cyclopentyl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone.
| Compound Name | [(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-(oxolan-3-yl)cyclopentyl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone |
|---|---|
| PubChem CID | 58305908 |
| Molecular Formula | C27H37F3N4O4 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | [(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-(oxolan-3-yl)cyclopentyl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone |
| SMILES | CO[C@@H]1COCC[C@@H]1N[C@@H]1CC[C@@](C(=O)N2C[C@H]3C[C@@H]2CN3c2cc(C(F)(F)F)ccn2)(C2CCOC2)C1 |
| InChI | InChI=1S/C27H37F3N4O4/c1-36-23-16-38-9-5-22(23)32-19-2-6-26(12-19,18-4-8-37-15-18)25(35)34-14-20-11-21(34)13-33(20)24-10-17(3-7-31-24)27(28,29)30/h3,7,10,18-23,32H,2,4-6,8-9,11-16H2,1H3/t18?,19-,20-,21-,22+,23-,26+/m1/s1 |
| InChIKey | QJHKLMYFYDLCCZ-WSNBBILTSA-N |
| XLogP | 2.86 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |