About 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one
4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58306164) has the molecular formula C20H33N5O2
and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| PubChem CID | 58306164 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCC[C@H](C)Oc1nc(N)c2c(n1)N(CCCCC1CCNCC1)C(=O)C2 |
| InChI | InChI=1S/C20H33N5O2/c1-3-6-14(2)27-20-23-18(21)16-13-17(26)25(19(16)24-20)12-5-4-7-15-8-10-22-11-9-15/h14-15,22H,3-13H2,1-2H3,(H2,21,23,24)/t14-/m0/s1 |
| InChIKey | WNRGVEKBMFHBRF-AWEZNQCLSA-N |
| XLogP | 2.69 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one?
The IUPAC name of 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one (CID 58306164) is 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one.
What is the SMILES notation for 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one?
The canonical SMILES for 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one is CCC[C@H](C)Oc1nc(N)c2c(n1)N(CCCCC1CCNCC1)C(=O)C2.
What is the InChIKey of 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one?
The InChIKey is WNRGVEKBMFHBRF-AWEZNQCLSA-N. The full InChI is InChI=1S/C20H33N5O2/c1-3-6-14(2)27-20-23-18(21)16-13-17(26)25(19(16)24-20)12-5-4-7-15-8-10-22-11-9-15/h14-15,22H,3-13H2,1-2H3,(H2,21,23,24)/t14-/m0/s1.
What are the key properties of 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one?
4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one has a molecular weight of 375.52 g/mol, XLogP of 2.69, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[(2S)-pentan-2-yl]oxy-7-(4-piperidin-4-ylbutyl)-5H-pyrrolo[2,3-d]pyrimidin-6-one is sourced from PubChem (CID 58306164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).