C13H17NOSi — CID 58306284
2-trimethylsilyloxy-1,3-dihydroindene-2-carbonitrile (PubChem CID 58306284) has the molecular formula C13H17NOSi and a molecular weight of 231.37 g/mol. Its IUPAC name is 2-trimethylsilyloxy-1,3-dihydroindene-2-carbonitrile.
| Compound Name | 2-trimethylsilyloxy-1,3-dihydroindene-2-carbonitrile |
|---|---|
| PubChem CID | 58306284 |
| Molecular Formula | C13H17NOSi |
| Molecular Weight | 231.37 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-trimethylsilyloxy-1,3-dihydroindene-2-carbonitrile |
| SMILES | C[Si](C)(C)OC1(C#N)Cc2ccccc2C1 |
| InChI | InChI=1S/C13H17NOSi/c1-16(2,3)15-13(10-14)8-11-6-4-5-7-12(11)9-13/h4-7H,8-9H2,1-3H3 |
| InChIKey | KVSVRIIZOHMPAQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|