About 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid
4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid (PubChem CID 58306529) has the molecular formula C28H23N3O3S
and a molecular weight of 481.58 g/mol. Its IUPAC name is 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid |
| PubChem CID | 58306529 |
| Molecular Formula | C28H23N3O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid |
| SMILES | C[C@H](NC(=O)c1cccc2ccn(Cc3ccc(-c4nccs4)cc3)c12)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H23N3O3S/c1-18(20-9-11-23(12-10-20)28(33)34)30-26(32)24-4-2-3-21-13-15-31(25(21)24)17-19-5-7-22(8-6-19)27-29-14-16-35-27/h2-16,18H,17H2,1H3,(H,30,32)(H,33,34)/t18-/m0/s1 |
| InChIKey | WHSBMIDYFBOPIZ-SFHVURJKSA-N |
| XLogP | 6.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid?
The IUPAC name of 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid (CID 58306529) is 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid.
What is the SMILES notation for 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid?
The canonical SMILES for 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid is C[C@H](NC(=O)c1cccc2ccn(Cc3ccc(-c4nccs4)cc3)c12)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid?
The InChIKey is WHSBMIDYFBOPIZ-SFHVURJKSA-N. The full InChI is InChI=1S/C28H23N3O3S/c1-18(20-9-11-23(12-10-20)28(33)34)30-26(32)24-4-2-3-21-13-15-31(25(21)24)17-19-5-7-22(8-6-19)27-29-14-16-35-27/h2-16,18H,17H2,1H3,(H,30,32)(H,33,34)/t18-/m0/s1.
What are the key properties of 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid?
4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid has a molecular weight of 481.58 g/mol, XLogP of 6.00, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S)-1-[[1-[[4-(1,3-thiazol-2-yl)phenyl]methyl]indole-7-carbonyl]amino]ethyl]benzoic acid is sourced from PubChem (CID 58306529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).