C28H23N3O3 — CID 58306765
4-[(1S)-1-[[1-(isoquinolin-3-ylmethyl)indole-7-carbonyl]amino]ethyl]benzoic acid (PubChem CID 58306765) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 4-[(1S)-1-[[1-(isoquinolin-3-ylmethyl)indole-7-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(1S)-1-[[1-(isoquinolin-3-ylmethyl)indole-7-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 58306765 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 4-[(1S)-1-[[1-(isoquinolin-3-ylmethyl)indole-7-carbonyl]amino]ethyl]benzoic acid |
| SMILES | C[C@H](NC(=O)c1cccc2ccn(Cc3cc4ccccc4cn3)c12)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H23N3O3/c1-18(19-9-11-21(12-10-19)28(33)34)30-27(32)25-8-4-7-20-13-14-31(26(20)25)17-24-15-22-5-2-3-6-23(22)16-29-24/h2-16,18H,17H2,1H3,(H,30,32)(H,33,34)/t18-/m0/s1 |
| InChIKey | RKQNECVKFQXJBL-SFHVURJKSA-N |
| XLogP | 5.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |