About ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate
ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate (PubChem CID 58307090) has the molecular formula C22H17F3N2O2S
and a molecular weight of 430.45 g/mol. Its IUPAC name is ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate |
| PubChem CID | 58307090 |
| Molecular Formula | C22H17F3N2O2S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate |
| SMILES | CCOC(=O)c1cc(C(F)(F)F)cc2ccn(Cc3csc(-c4ccccc4)n3)c12 |
| InChI | InChI=1S/C22H17F3N2O2S/c1-2-29-21(28)18-11-16(22(23,24)25)10-15-8-9-27(19(15)18)12-17-13-30-20(26-17)14-6-4-3-5-7-14/h3-11,13H,2,12H2,1H3 |
| InChIKey | OWPNSVUEOUBWJL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate?
The IUPAC name of ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate (CID 58307090) is ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate.
What is the SMILES notation for ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate?
The canonical SMILES for ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate is CCOC(=O)c1cc(C(F)(F)F)cc2ccn(Cc3csc(-c4ccccc4)n3)c12.
What is the InChIKey of ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate?
The InChIKey is OWPNSVUEOUBWJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F3N2O2S/c1-2-29-21(28)18-11-16(22(23,24)25)10-15-8-9-27(19(15)18)12-17-13-30-20(26-17)14-6-4-3-5-7-14/h3-11,13H,2,12H2,1H3.
What are the key properties of ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate?
ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate has a molecular weight of 430.45 g/mol, XLogP of 6.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5-(trifluoromethyl)indole-7-carboxylate is sourced from PubChem (CID 58307090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).