C34H34Cl2N4O4 — CID 58307118
1-[5-[4-(4-amino-4-oxobutoxy)phenyl]-4-(2,4-dichlorophenyl)-1-methylpyrrole-2-carbonyl]-4-phenylpiperidine-4-carboxamide (PubChem CID 58307118) has the molecular formula C34H34Cl2N4O4 and a molecular weight of 633.58 g/mol. Its IUPAC name is 1-[5-[4-(4-amino-4-oxobutoxy)phenyl]-4-(2,4-dichlorophenyl)-1-methylpyrrole-2-carbonyl]-4-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[5-[4-(4-amino-4-oxobutoxy)phenyl]-4-(2,4-dichlorophenyl)-1-methylpyrrole-2-carbonyl]-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58307118 |
| Molecular Formula | C34H34Cl2N4O4 |
| Molecular Weight | 633.58 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | 1-[5-[4-(4-amino-4-oxobutoxy)phenyl]-4-(2,4-dichlorophenyl)-1-methylpyrrole-2-carbonyl]-4-phenylpiperidine-4-carboxamide |
| SMILES | Cn1c(C(=O)N2CCC(C(N)=O)(c3ccccc3)CC2)cc(-c2ccc(Cl)cc2Cl)c1-c1ccc(OCCCC(N)=O)cc1 |
| InChI | InChI=1S/C34H34Cl2N4O4/c1-39-29(32(42)40-17-15-34(16-18-40,33(38)43)23-6-3-2-4-7-23)21-27(26-14-11-24(35)20-28(26)36)31(39)22-9-12-25(13-10-22)44-19-5-8-30(37)41/h2-4,6-7,9-14,20-21H,5,8,15-19H2,1H3,(H2,37,41)(H2,38,43) |
| InChIKey | XXYDCTTVSPVNJA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 120.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|