C23H18F2N2O6 — CID 58307268
3-(difluoromethoxy)-N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]benzamide (PubChem CID 58307268) has the molecular formula C23H18F2N2O6 and a molecular weight of 456.40 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 58307268 |
| Molecular Formula | C23H18F2N2O6 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 3-(difluoromethoxy)-N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]benzamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC(=O)c4cccc(OC(F)F)c4)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C23H18F2N2O6/c24-23(25)33-15-5-1-3-12(9-15)20(30)26-11-13-4-2-6-16-19(13)22(32)27(21(16)31)17-8-7-14(28)10-18(17)29/h1-6,9,17,23H,7-8,10-11H2,(H,26,30) |
| InChIKey | HHZGSKMEWSUBDE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|