C9H19NO — CID 58307513
(2S,4S)-3-ethyl-2,4,5,5-tetramethyl-1,3-oxazolidine (PubChem CID 58307513) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (2S,4S)-3-ethyl-2,4,5,5-tetramethyl-1,3-oxazolidine.
| Compound Name | (2S,4S)-3-ethyl-2,4,5,5-tetramethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 58307513 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (2S,4S)-3-ethyl-2,4,5,5-tetramethyl-1,3-oxazolidine |
| SMILES | CCN1[C@H](C)OC(C)(C)[C@@H]1C |
| InChI | InChI=1S/C9H19NO/c1-6-10-7(2)9(4,5)11-8(10)3/h7-8H,6H2,1-5H3/t7-,8-/m0/s1 |
| InChIKey | MYOOROQPZKSMNZ-YUMQZZPRSA-N |
| XLogP | 1.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |