About 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium
3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium (PubChem CID 58307592) has the molecular formula C11H24N+
and a molecular weight of 170.32 g/mol. Its IUPAC name is 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium.
Molecular Properties
| Compound Name | 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium |
| PubChem CID | 58307592 |
| Molecular Formula | C11H24N+ |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.19 |
| IUPAC Name | 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium |
| SMILES | CC1C[N+](C)(C)CC1C(C)(C)C |
| InChI | InChI=1S/C11H24N/c1-9-7-12(5,6)8-10(9)11(2,3)4/h9-10H,7-8H2,1-6H3/q+1 |
| InChIKey | CZMUXMGNBKXSNT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium?
The IUPAC name of 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium (CID 58307592) is 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium.
What is the SMILES notation for 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium?
The canonical SMILES for 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium is CC1C[N+](C)(C)CC1C(C)(C)C.
What is the InChIKey of 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium?
The InChIKey is CZMUXMGNBKXSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N/c1-9-7-12(5,6)8-10(9)11(2,3)4/h9-10H,7-8H2,1-6H3/q+1.
What are the key properties of 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium?
3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium has a molecular weight of 170.32 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1,1,4-trimethylpyrrolidin-1-ium is sourced from PubChem (CID 58307592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).