C16H17F3O3 — CID 583078
(7,7-dimethyl-10-oxo-5,6,8,9-tetrahydrobenzo[8]annulen-5-yl) 2,2,2-trifluoroacetate (PubChem CID 583078) has the molecular formula C16H17F3O3 and a molecular weight of 314.30 g/mol. Its IUPAC name is (7,7-dimethyl-10-oxo-5,6,8,9-tetrahydrobenzo[8]annulen-5-yl) 2,2,2-trifluoroacetate.
| Compound Name | (7,7-dimethyl-10-oxo-5,6,8,9-tetrahydrobenzo[8]annulen-5-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 583078 |
| Molecular Formula | C16H17F3O3 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (7,7-dimethyl-10-oxo-5,6,8,9-tetrahydrobenzo[8]annulen-5-yl) 2,2,2-trifluoroacetate |
| SMILES | CC1(C)CCC(=O)c2ccccc2C(OC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C16H17F3O3/c1-15(2)8-7-12(20)10-5-3-4-6-11(10)13(9-15)22-14(21)16(17,18)19/h3-6,13H,7-9H2,1-2H3 |
| InChIKey | VBRSVWXPHYYCAM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |