C31H52O16S5 — CID 58307850
1-[[2,3,5,6-tetrakis[1-(2-sulfanylpropanoyloxy)ethoxy]oxan-4-yl]methoxy]ethyl 2-sulfanylpropanoate (PubChem CID 58307850) has the molecular formula C31H52O16S5 and a molecular weight of 841.08 g/mol. Its IUPAC name is 1-[[2,3,5,6-tetrakis[1-(2-sulfanylpropanoyloxy)ethoxy]oxan-4-yl]methoxy]ethyl 2-sulfanylpropanoate.
| Compound Name | 1-[[2,3,5,6-tetrakis[1-(2-sulfanylpropanoyloxy)ethoxy]oxan-4-yl]methoxy]ethyl 2-sulfanylpropanoate |
|---|---|
| PubChem CID | 58307850 |
| Molecular Formula | C31H52O16S5 |
| Molecular Weight | 841.08 g/mol |
| Exact Mass | 840.19 |
| IUPAC Name | 1-[[2,3,5,6-tetrakis[1-(2-sulfanylpropanoyloxy)ethoxy]oxan-4-yl]methoxy]ethyl 2-sulfanylpropanoate |
| SMILES | CC(OCC1C(OC(C)OC(=O)C(C)S)C(OC(C)OC(=O)C(C)S)OC(OC(C)OC(=O)C(C)S)C1OC(C)OC(=O)C(C)S)OC(=O)C(C)S |
| InChI | InChI=1S/C31H52O16S5/c1-12(48)25(32)40-17(6)37-11-22-23(38-18(7)41-26(33)13(2)49)30(45-20(9)43-28(35)15(4)51)47-31(46-21(10)44-29(36)16(5)52)24(22)39-19(8)42-27(34)14(3)50/h12-24,30-31,48-52H,11H2,1-10H3 |
| InChIKey | ZUPRVMCHYIAVGG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 186.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.08 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|