About 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid
1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid (PubChem CID 58307869) has the molecular formula C12H15N2O2+
and a molecular weight of 219.26 g/mol. Its IUPAC name is 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid |
| PubChem CID | 58307869 |
| Molecular Formula | C12H15N2O2+ |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid |
| SMILES | C[N+]1=C(C(=O)O)N(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C12H14N2O2/c1-13-7-8-14(11(13)12(15)16)9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3/p+1 |
| InChIKey | WFPUETSBVBUUSL-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid?
The IUPAC name of 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid (CID 58307869) is 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid.
What is the SMILES notation for 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid?
The canonical SMILES for 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid is C[N+]1=C(C(=O)O)N(Cc2ccccc2)CC1.
What is the InChIKey of 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid?
The InChIKey is WFPUETSBVBUUSL-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H14N2O2/c1-13-7-8-14(11(13)12(15)16)9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3/p+1.
What are the key properties of 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid?
1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid has a molecular weight of 219.26 g/mol, XLogP of 0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid is sourced from PubChem (CID 58307869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).