C28H42ClN7O7 — CID 58308170
3,5-diamino-N-[1-amino-6-[4-[2-[[(2S,3S,4R)-2,3,4-trihydroxy-5-[(2R,4S)-2-methyl-1,3-dioxolan-4-yl]pentyl]amino]ethoxy]phenyl]hexylidene]-6-chloropyrazine-2-carboxamide (PubChem CID 58308170) has the molecular formula C28H42ClN7O7 and a molecular weight of 624.14 g/mol. Its IUPAC name is 3,5-diamino-N-[1-amino-6-[4-[2-[[(2S,3S,4R)-2,3,4-trihydroxy-5-[(2R,4S)-2-methyl-1,3-dioxolan-4-yl]pentyl]amino]ethoxy]phenyl]hexylidene]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[1-amino-6-[4-[2-[[(2S,3S,4R)-2,3,4-trihydroxy-5-[(2R,4S)-2-methyl-1,3-dioxolan-4-yl]pentyl]amino]ethoxy]phenyl]hexylidene]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58308170 |
| Molecular Formula | C28H42ClN7O7 |
| Molecular Weight | 624.14 g/mol |
| Exact Mass | 623.28 |
| IUPAC Name | 3,5-diamino-N-[1-amino-6-[4-[2-[[(2S,3S,4R)-2,3,4-trihydroxy-5-[(2R,4S)-2-methyl-1,3-dioxolan-4-yl]pentyl]amino]ethoxy]phenyl]hexylidene]-6-chloropyrazine-2-carboxamide |
| SMILES | C[C@@H]1OC[C@H](C[C@@H](O)[C@H](O)[C@@H](O)CNCCOc2ccc(CCCCC/C(N)=N\C(=O)c3nc(Cl)c(N)nc3N)cc2)O1 |
| InChI | InChI=1S/C28H42ClN7O7/c1-16-42-15-19(43-16)13-20(37)24(39)21(38)14-33-11-12-41-18-9-7-17(8-10-18)5-3-2-4-6-22(30)34-28(40)23-26(31)36-27(32)25(29)35-23/h7-10,16,19-21,24,33,37-39H,2-6,11-15H2,1H3,(H2,30,34,40)(H4,31,32,36)/t16-,19+,20-,21+,24+/m1/s1 |
| InChIKey | QPBSWVFAAAFSBY-SGLPDKLRSA-N |
| XLogP | 0.80 |
| TPSA | 233.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.14 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|