C25H41NO7 — CID 58308916
2-(3-methylbuta-1,3-dien-2-yloxy)ethyl 5,7,7-trimethyl-8-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]octanoate (PubChem CID 58308916) has the molecular formula C25H41NO7 and a molecular weight of 467.60 g/mol. Its IUPAC name is 2-(3-methylbuta-1,3-dien-2-yloxy)ethyl 5,7,7-trimethyl-8-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]octanoate.
| Compound Name | 2-(3-methylbuta-1,3-dien-2-yloxy)ethyl 5,7,7-trimethyl-8-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]octanoate |
|---|---|
| PubChem CID | 58308916 |
| Molecular Formula | C25H41NO7 |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 2-(3-methylbuta-1,3-dien-2-yloxy)ethyl 5,7,7-trimethyl-8-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]octanoate |
| SMILES | C=C(C)C(=C)OCCOC(=O)CCCC(C)CC(C)(C)CNC(=O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C25H41NO7/c1-18(2)21(6)30-12-13-31-22(27)11-9-10-20(5)16-25(7,8)17-26-24(29)33-15-14-32-23(28)19(3)4/h20H,1,3,6,9-17H2,2,4-5,7-8H3,(H,26,29) |
| InChIKey | MGXCPCXJVHPONZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|