C42H33F7O12 — CID 58309130
[4-[2,3-difluoro-4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-3-[(3,4,5-trifluorophenyl)methoxycarbonyl]phenyl] 2,3-difluoro-4-(1-hydroxy-4-prop-2-enoyloxybutyl)benzoate (PubChem CID 58309130) has the molecular formula C42H33F7O12 and a molecular weight of 862.70 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-3-[(3,4,5-trifluorophenyl)methoxycarbonyl]phenyl] 2,3-difluoro-4-(1-hydroxy-4-prop-2-enoyloxybutyl)benzoate.
| Compound Name | [4-[2,3-difluoro-4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-3-[(3,4,5-trifluorophenyl)methoxycarbonyl]phenyl] 2,3-difluoro-4-(1-hydroxy-4-prop-2-enoyloxybutyl)benzoate |
|---|---|
| PubChem CID | 58309130 |
| Molecular Formula | C42H33F7O12 |
| Molecular Weight | 862.70 g/mol |
| Exact Mass | 862.19 |
| IUPAC Name | [4-[2,3-difluoro-4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-3-[(3,4,5-trifluorophenyl)methoxycarbonyl]phenyl] 2,3-difluoro-4-(1-hydroxy-4-prop-2-enoyloxybutyl)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(C(O)CCCOC(=O)C=C)c(F)c3F)cc2C(=O)OCc2cc(F)c(F)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C42H33F7O12/c1-3-33(51)57-16-6-5-15-56-32-14-12-26(37(47)39(32)49)42(55)61-31-13-9-23(20-27(31)40(53)59-21-22-18-28(43)38(48)29(44)19-22)60-41(54)25-11-10-24(35(45)36(25)46)30(50)8-7-17-58-34(52)4-2/h3-4,9-14,18-20,30,50H,1-2,5-8,15-17,21H2 |
| InChIKey | QANRUOOEOQSJJK-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.70 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|