C28H28N2O5 — CID 58309304
1-O-ethyl 4-O-(1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl) butanedioate (PubChem CID 58309304) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is 1-O-ethyl 4-O-(1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl) butanedioate.
| Compound Name | 1-O-ethyl 4-O-(1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl) butanedioate |
|---|---|
| PubChem CID | 58309304 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 1-O-ethyl 4-O-(1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl) butanedioate |
| SMILES | CCOC(=O)CCC(=O)Oc1ccc2ccc3c(c2c1)N=CC1(O3)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C28H28N2O5/c1-5-33-24(31)14-15-25(32)34-19-12-10-18-11-13-23-26(20(18)16-19)29-17-28(35-23)27(2,3)21-8-6-7-9-22(21)30(28)4/h6-13,16-17H,5,14-15H2,1-4H3 |
| InChIKey | NETVSBHMGPAVEO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|