C52H62O11Si2 — CID 58309308
4-O-[2-[2,2-bis(4-methoxyphenyl)-6-phenylbenzo[h]chromene-5-carbonyl]oxyethyl] 1-O-[2-[3-[[dimethyl(propyl)silyl]oxy-dimethylsilyl]propoxy]ethyl] butanedioate (PubChem CID 58309308) has the molecular formula C52H62O11Si2 and a molecular weight of 919.23 g/mol. Its IUPAC name is 4-O-[2-[2,2-bis(4-methoxyphenyl)-6-phenylbenzo[h]chromene-5-carbonyl]oxyethyl] 1-O-[2-[3-[[dimethyl(propyl)silyl]oxy-dimethylsilyl]propoxy]ethyl] butanedioate.
| Compound Name | 4-O-[2-[2,2-bis(4-methoxyphenyl)-6-phenylbenzo[h]chromene-5-carbonyl]oxyethyl] 1-O-[2-[3-[[dimethyl(propyl)silyl]oxy-dimethylsilyl]propoxy]ethyl] butanedioate |
|---|---|
| PubChem CID | 58309308 |
| Molecular Formula | C52H62O11Si2 |
| Molecular Weight | 919.23 g/mol |
| Exact Mass | 918.38 |
| IUPAC Name | 4-O-[2-[2,2-bis(4-methoxyphenyl)-6-phenylbenzo[h]chromene-5-carbonyl]oxyethyl] 1-O-[2-[3-[[dimethyl(propyl)silyl]oxy-dimethylsilyl]propoxy]ethyl] butanedioate |
| SMILES | CCC[Si](C)(C)O[Si](C)(C)CCCOCCOC(=O)CCC(=O)OCCOC(=O)c1c2c(c3ccccc3c1-c1ccccc1)OC(c1ccc(OC)cc1)(c1ccc(OC)cc1)C=C2 |
| InChI | InChI=1S/C52H62O11Si2/c1-8-36-64(4,5)63-65(6,7)37-14-31-58-32-33-59-46(53)27-28-47(54)60-34-35-61-51(55)49-45-29-30-52(39-19-23-41(56-2)24-20-39,40-21-25-42(57-3)26-22-40)62-50(45)44-18-13-12-17-43(44)48(49)38-15-10-9-11-16-38/h9-13,15-26,29-30H,8,14,27-28,31-37H2,1-7H3 |
| InChIKey | JIGWKNSKOYRFSJ-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.23 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|