C36H32BNO2 — CID 58309341
3,6-diphenyl-9-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole (PubChem CID 58309341) has the molecular formula C36H32BNO2 and a molecular weight of 521.47 g/mol. Its IUPAC name is 3,6-diphenyl-9-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole.
| Compound Name | 3,6-diphenyl-9-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 58309341 |
| Molecular Formula | C36H32BNO2 |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 3,6-diphenyl-9-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole |
| SMILES | CC1(C)OB(c2cccc(-n3c4ccc(-c5ccccc5)cc4c4cc(-c5ccccc5)ccc43)c2)OC1(C)C |
| InChI | InChI=1S/C36H32BNO2/c1-35(2)36(3,4)40-37(39-35)29-16-11-17-30(24-29)38-33-20-18-27(25-12-7-5-8-13-25)22-31(33)32-23-28(19-21-34(32)38)26-14-9-6-10-15-26/h5-24H,1-4H3 |
| InChIKey | PXHHNXSPPVLYCK-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|