About Carbachol
Carbachol (PubChem CID 5831) has the molecular formula C6H15ClN2O2
and a molecular weight of 182.65 g/mol. Its IUPAC name is 2-carbamoyloxyethyl(trimethyl)azanium chloride.
Molecular Properties
| Compound Name | Carbachol |
| PubChem CID | 5831 |
| Molecular Formula | C6H15ClN2O2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2-carbamoyloxyethyl(trimethyl)azanium chloride |
| SMILES | C[N+](C)(C)CCOC(=O)N.[Cl-] |
| InChI | InChI=1S/C6H14N2O2.ClH/c1-8(2,3)4-5-10-6(7)9;/h4-5H2,1-3H3,(H-,7,9);1H |
| InChIKey | AIXAANGOTKPUOY-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | 117 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze Carbachol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Carbachol?
The IUPAC name of Carbachol (CID 5831) is 2-carbamoyloxyethyl(trimethyl)azanium chloride.
What is the SMILES notation for Carbachol?
The canonical SMILES for Carbachol is C[N+](C)(C)CCOC(=O)N.[Cl-].
What is the InChIKey of Carbachol?
The InChIKey is AIXAANGOTKPUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2.ClH/c1-8(2,3)4-5-10-6(7)9;/h4-5H2,1-3H3,(H-,7,9);1H.
What are the key properties of Carbachol?
Carbachol has a molecular weight of 182.65 g/mol, XLogP of not available, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Carbachol is sourced from PubChem (CID 5831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).