C14H20N2O2 — CID 58310195
2,5-ditert-butylpyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 58310195) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2,5-ditert-butylpyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | 2,5-ditert-butylpyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 58310195 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2,5-ditert-butylpyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | CC(C)(C)N1C(=O)c2cn(C(C)(C)C)cc2C1=O |
| InChI | InChI=1S/C14H20N2O2/c1-13(2,3)15-7-9-10(8-15)12(18)16(11(9)17)14(4,5)6/h7-8H,1-6H3 |
| InChIKey | MSUWRJMSTSCJOF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|