C11H8BrF3N4O — CID 58310526
1-(7-bromo-1,5-naphthyridin-4-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 58310526) has the molecular formula C11H8BrF3N4O and a molecular weight of 349.11 g/mol. Its IUPAC name is 1-(7-bromo-1,5-naphthyridin-4-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(7-bromo-1,5-naphthyridin-4-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 58310526 |
| Molecular Formula | C11H8BrF3N4O |
| Molecular Weight | 349.11 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 1-(7-bromo-1,5-naphthyridin-4-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1ccnc2cc(Br)cnc12 |
| InChI | InChI=1S/C11H8BrF3N4O/c12-6-3-8-9(17-4-6)7(1-2-16-8)19-10(20)18-5-11(13,14)15/h1-4H,5H2,(H2,16,18,19,20) |
| InChIKey | ONTHFJFBDDIPAN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.11 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |