C24H29N5O3 — CID 58310681
N-[2-[2-(dimethylamino)ethyl-methylamino]oxy-4-(1H-pyrazol-4-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 58310681) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]oxy-4-(1H-pyrazol-4-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]oxy-4-(1H-pyrazol-4-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 58310681 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]oxy-4-(1H-pyrazol-4-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | CN(C)CCN(C)Oc1cc(-c2cn[nH]c2)ccc1NC(=O)C1COc2ccccc2C1 |
| InChI | InChI=1S/C24H29N5O3/c1-28(2)10-11-29(3)32-23-13-17(20-14-25-26-15-20)8-9-21(23)27-24(30)19-12-18-6-4-5-7-22(18)31-16-19/h4-9,13-15,19H,10-12,16H2,1-3H3,(H,25,26)(H,27,30) |
| InChIKey | FOQCUXLWENAIFZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|