C42H67NO7S — CID 58311004
(3R,14R,17S,18R,20S)-3-[3-[1-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxopropyl]-14-(3-cyclopropyl-2-oxopropanoyl)-19,19-dimethyl-1-azatricyclo[15.4.0.018,20]henicosane-2,16-dione (PubChem CID 58311004) has the molecular formula C42H67NO7S and a molecular weight of 730.06 g/mol. Its IUPAC name is (3R,14R,17S,18R,20S)-3-[3-[1-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxopropyl]-14-(3-cyclopropyl-2-oxopropanoyl)-19,19-dimethyl-1-azatricyclo[15.4.0.018,20]henicosane-2,16-dione.
| Compound Name | (3R,14R,17S,18R,20S)-3-[3-[1-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxopropyl]-14-(3-cyclopropyl-2-oxopropanoyl)-19,19-dimethyl-1-azatricyclo[15.4.0.018,20]henicosane-2,16-dione |
|---|---|
| PubChem CID | 58311004 |
| Molecular Formula | C42H67NO7S |
| Molecular Weight | 730.06 g/mol |
| Exact Mass | 729.46 |
| IUPAC Name | (3R,14R,17S,18R,20S)-3-[3-[1-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxopropyl]-14-(3-cyclopropyl-2-oxopropanoyl)-19,19-dimethyl-1-azatricyclo[15.4.0.018,20]henicosane-2,16-dione |
| SMILES | CC1(C)[C@@H]2[C@H]3C(=O)C[C@H](C(=O)C(=O)CC4CC4)CCCCCCCCCC[C@H](CC(=O)CC4(CS(=O)(=O)C(C)(C)C)CCCCC4)C(=O)N3C[C@@H]21 |
| InChI | InChI=1S/C42H67NO7S/c1-40(2,3)51(49,50)28-42(21-15-12-16-22-42)26-32(44)24-31-18-14-11-9-7-6-8-10-13-17-30(38(47)35(46)23-29-19-20-29)25-34(45)37-36-33(41(36,4)5)27-43(37)39(31)48/h29-31,33,36-37H,6-28H2,1-5H3/t30-,31-,33+,36+,37-/m1/s1 |
| InChIKey | ULUDQHDRIZVBRB-VSDAYDPRSA-N |
| XLogP | 8.03 |
| TPSA | 122.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.06 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|