C34H51F2NO5 — CID 58311008
(3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-3-(4,4-dimethyl-2-oxopentyl)-6,6-difluoro-18,18-dimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione (PubChem CID 58311008) has the molecular formula C34H51F2NO5 and a molecular weight of 591.78 g/mol. Its IUPAC name is (3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-3-(4,4-dimethyl-2-oxopentyl)-6,6-difluoro-18,18-dimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione.
| Compound Name | (3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-3-(4,4-dimethyl-2-oxopentyl)-6,6-difluoro-18,18-dimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
|---|---|
| PubChem CID | 58311008 |
| Molecular Formula | C34H51F2NO5 |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 591.37 |
| IUPAC Name | (3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-3-(4,4-dimethyl-2-oxopentyl)-6,6-difluoro-18,18-dimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
| SMILES | CC(C)(C)CC(=O)C[C@H]1CCC(F)(F)CCCCCC[C@@H](C(=O)C(=O)CC2CC2)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C34H51F2NO5/c1-32(2,3)19-24(38)17-23-13-15-34(35,36)14-9-7-6-8-10-22(30(41)27(40)16-21-11-12-21)18-26(39)29-28-25(33(28,4)5)20-37(29)31(23)42/h21-23,25,28-29H,6-20H2,1-5H3/t22-,23-,25+,28+,29-/m1/s1 |
| InChIKey | XRARHLPMUWVFQU-YYIQZPQXSA-N |
| XLogP | 6.76 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|