C40H63NO7S — CID 58311016
(3R,12R,15S,16R,18S)-3-[3-[1-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxopropyl]-12-(3-cyclopropyl-2-oxopropanoyl)-17,17-dimethyl-1-azatricyclo[13.4.0.016,18]nonadecane-2,14-dione (PubChem CID 58311016) has the molecular formula C40H63NO7S and a molecular weight of 702.01 g/mol. Its IUPAC name is (3R,12R,15S,16R,18S)-3-[3-[1-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxopropyl]-12-(3-cyclopropyl-2-oxopropanoyl)-17,17-dimethyl-1-azatricyclo[13.4.0.016,18]nonadecane-2,14-dione.
| Compound Name | (3R,12R,15S,16R,18S)-3-[3-[1-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxopropyl]-12-(3-cyclopropyl-2-oxopropanoyl)-17,17-dimethyl-1-azatricyclo[13.4.0.016,18]nonadecane-2,14-dione |
|---|---|
| PubChem CID | 58311016 |
| Molecular Formula | C40H63NO7S |
| Molecular Weight | 702.01 g/mol |
| Exact Mass | 701.43 |
| IUPAC Name | (3R,12R,15S,16R,18S)-3-[3-[1-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxopropyl]-12-(3-cyclopropyl-2-oxopropanoyl)-17,17-dimethyl-1-azatricyclo[13.4.0.016,18]nonadecane-2,14-dione |
| SMILES | CC1(C)[C@@H]2[C@H]3C(=O)C[C@H](C(=O)C(=O)CC4CC4)CCCCCCCC[C@H](CC(=O)CC4(CS(=O)(=O)C(C)(C)C)CCCCC4)C(=O)N3C[C@@H]21 |
| InChI | InChI=1S/C40H63NO7S/c1-38(2,3)49(47,48)26-40(19-13-10-14-20-40)24-30(42)22-29-16-12-9-7-6-8-11-15-28(36(45)33(44)21-27-17-18-27)23-32(43)35-34-31(39(34,4)5)25-41(35)37(29)46/h27-29,31,34-35H,6-26H2,1-5H3/t28-,29-,31+,34+,35-/m1/s1 |
| InChIKey | DBWTWRWKSPZDOL-AIQDRPMTSA-N |
| XLogP | 7.25 |
| TPSA | 122.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.01 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|