C39H59NO7S — CID 58311020
(3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-3-[3-[1-[(2S)-1,1-dioxothietan-2-yl]cyclohexyl]-2-oxopropyl]-18,18-dimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione (PubChem CID 58311020) has the molecular formula C39H59NO7S and a molecular weight of 685.97 g/mol. Its IUPAC name is (3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-3-[3-[1-[(2S)-1,1-dioxothietan-2-yl]cyclohexyl]-2-oxopropyl]-18,18-dimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione.
| Compound Name | (3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-3-[3-[1-[(2S)-1,1-dioxothietan-2-yl]cyclohexyl]-2-oxopropyl]-18,18-dimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
|---|---|
| PubChem CID | 58311020 |
| Molecular Formula | C39H59NO7S |
| Molecular Weight | 685.97 g/mol |
| Exact Mass | 685.40 |
| IUPAC Name | (3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-3-[3-[1-[(2S)-1,1-dioxothietan-2-yl]cyclohexyl]-2-oxopropyl]-18,18-dimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
| SMILES | CC1(C)[C@@H]2[C@H]3C(=O)C[C@H](C(=O)C(=O)CC4CC4)CCCCCCCCC[C@H](CC(=O)CC4([C@@H]5CCS5(=O)=O)CCCCC4)C(=O)N3C[C@@H]21 |
| InChI | InChI=1S/C39H59NO7S/c1-38(2)30-25-40-35(34(30)38)31(42)23-27(36(44)32(43)21-26-15-16-26)13-9-6-4-3-5-7-10-14-28(37(40)45)22-29(41)24-39(18-11-8-12-19-39)33-17-20-48(33,46)47/h26-28,30,33-35H,3-25H2,1-2H3/t27-,28-,30+,33+,34+,35-/m1/s1 |
| InChIKey | RHWSRGNZUHTQGY-UHBRATLMSA-N |
| XLogP | 6.61 |
| TPSA | 122.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.97 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|