C27H43NO4 — CID 58311043
methyl (3S,8E,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicos-8-ene-14-carboxylate (PubChem CID 58311043) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is methyl (3S,8E,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicos-8-ene-14-carboxylate.
| Compound Name | methyl (3S,8E,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicos-8-ene-14-carboxylate |
|---|---|
| PubChem CID | 58311043 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | methyl (3S,8E,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicos-8-ene-14-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCC/C=C/CCCC(C)(C)[C@H](C)C(=O)N2CC3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C27H43NO4/c1-18-24(30)28-17-20-22(27(20,4)5)23(28)21(29)16-19(25(31)32-6)14-12-10-8-7-9-11-13-15-26(18,2)3/h7,9,18-20,22-23H,8,10-17H2,1-6H3/b9-7+/t18-,19-,20?,22+,23-/m1/s1 |
| InChIKey | ZDJOJRYNDBZHGU-OSSSZXNISA-N |
| XLogP | 5.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|