C26H45NO3 — CID 58311071
(3S,14R,17S,18R)-14-(hydroxymethyl)-3,4,4,19,19-pentamethyl-1-azatricyclo[15.4.0.018,20]henicosane-2,16-dione (PubChem CID 58311071) has the molecular formula C26H45NO3 and a molecular weight of 419.65 g/mol. Its IUPAC name is (3S,14R,17S,18R)-14-(hydroxymethyl)-3,4,4,19,19-pentamethyl-1-azatricyclo[15.4.0.018,20]henicosane-2,16-dione.
| Compound Name | (3S,14R,17S,18R)-14-(hydroxymethyl)-3,4,4,19,19-pentamethyl-1-azatricyclo[15.4.0.018,20]henicosane-2,16-dione |
|---|---|
| PubChem CID | 58311071 |
| Molecular Formula | C26H45NO3 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.34 |
| IUPAC Name | (3S,14R,17S,18R)-14-(hydroxymethyl)-3,4,4,19,19-pentamethyl-1-azatricyclo[15.4.0.018,20]henicosane-2,16-dione |
| SMILES | C[C@@H]1C(=O)N2CC3[C@@H]([C@H]2C(=O)C[C@H](CO)CCCCCCCCCC1(C)C)C3(C)C |
| InChI | InChI=1S/C26H45NO3/c1-18-24(30)27-16-20-22(26(20,4)5)23(27)21(29)15-19(17-28)13-11-9-7-6-8-10-12-14-25(18,2)3/h18-20,22-23,28H,6-17H2,1-5H3/t18-,19-,20?,22+,23-/m1/s1 |
| InChIKey | ORZGOTCZNIKORM-CCPZRIPKSA-N |
| XLogP | 5.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |