C30H49NO4 — CID 58311090
methyl (2R)-2-[2-[(1R,2S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylnon-8-enoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]oct-7-enoate (PubChem CID 58311090) has the molecular formula C30H49NO4 and a molecular weight of 487.73 g/mol. Its IUPAC name is methyl (2R)-2-[2-[(1R,2S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylnon-8-enoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]oct-7-enoate.
| Compound Name | methyl (2R)-2-[2-[(1R,2S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylnon-8-enoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]oct-7-enoate |
|---|---|
| PubChem CID | 58311090 |
| Molecular Formula | C30H49NO4 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.37 |
| IUPAC Name | methyl (2R)-2-[2-[(1R,2S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylnon-8-enoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]oct-7-enoate |
| SMILES | C=CCCCC[C@H](CC(=O)[C@@H]1[C@@H]2C(CN1C(=O)[C@@H](C)C(C)(C)CCCCC=C)C2(C)C)C(=O)OC |
| InChI | InChI=1S/C30H49NO4/c1-9-11-13-15-17-22(28(34)35-8)19-24(32)26-25-23(30(25,6)7)20-31(26)27(33)21(3)29(4,5)18-16-14-12-10-2/h9-10,21-23,25-26H,1-2,11-20H2,3-8H3/t21-,22-,23?,25+,26-/m1/s1 |
| InChIKey | NAGSHEXYSBGGSG-MGEXTOHLSA-N |
| XLogP | 6.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|