C31H49NO5 — CID 58311092
[4-cyclopropyl-2-oxo-1-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]butyl] acetate (PubChem CID 58311092) has the molecular formula C31H49NO5 and a molecular weight of 515.74 g/mol. Its IUPAC name is [4-cyclopropyl-2-oxo-1-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]butyl] acetate.
| Compound Name | [4-cyclopropyl-2-oxo-1-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]butyl] acetate |
|---|---|
| PubChem CID | 58311092 |
| Molecular Formula | C31H49NO5 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.36 |
| IUPAC Name | [4-cyclopropyl-2-oxo-1-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]butyl] acetate |
| SMILES | CC(=O)OC(C(=O)CCC1CC1)[C@@H]1CCCCCCCCC[C@H](C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C31H49NO5/c1-20-12-10-8-6-5-7-9-11-13-23(29(37-21(2)33)25(34)17-16-22-14-15-22)18-26(35)28-27-24(31(27,3)4)19-32(28)30(20)36/h20,22-24,27-29H,5-19H2,1-4H3/t20-,23+,24-,27-,28+,29?/m0/s1 |
| InChIKey | PQUAPIHWVYFWKE-APLCJCKDSA-N |
| XLogP | 5.90 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |