C37H60N2O7 — CID 58311128
tert-butyl 2-tert-butyl-5-[(3R,14R,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-3-yl]-4-oxopentanoate (PubChem CID 58311128) has the molecular formula C37H60N2O7 and a molecular weight of 644.89 g/mol. Its IUPAC name is tert-butyl 2-tert-butyl-5-[(3R,14R,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-3-yl]-4-oxopentanoate.
| Compound Name | tert-butyl 2-tert-butyl-5-[(3R,14R,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-3-yl]-4-oxopentanoate |
|---|---|
| PubChem CID | 58311128 |
| Molecular Formula | C37H60N2O7 |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.44 |
| IUPAC Name | tert-butyl 2-tert-butyl-5-[(3R,14R,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-3-yl]-4-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)C(CC(=O)C[C@H]1CCCCCCCCCC[C@@H](C(=O)C(N)=O)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C)C(C)(C)C |
| InChI | InChI=1S/C37H60N2O7/c1-35(2,3)26(34(45)46-36(4,5)6)21-25(40)19-24-18-16-14-12-10-9-11-13-15-17-23(31(42)32(38)43)20-28(41)30-29-27(37(29,7)8)22-39(30)33(24)44/h23-24,26-27,29-30H,9-22H2,1-8H3,(H2,38,43)/t23-,24-,26?,27+,29+,30-/m1/s1 |
| InChIKey | TWOBVCBGDABKMA-KADKJTAUSA-N |
| XLogP | 5.98 |
| TPSA | 140.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|