C33H50F2N2O5 — CID 58311140
N-cyclopropyl-2-[(3R,13R,16S,17R,19S)-3-(4,4-dimethyl-2-oxopentyl)-6,6-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxoacetamide (PubChem CID 58311140) has the molecular formula C33H50F2N2O5 and a molecular weight of 592.77 g/mol. Its IUPAC name is N-cyclopropyl-2-[(3R,13R,16S,17R,19S)-3-(4,4-dimethyl-2-oxopentyl)-6,6-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxoacetamide.
| Compound Name | N-cyclopropyl-2-[(3R,13R,16S,17R,19S)-3-(4,4-dimethyl-2-oxopentyl)-6,6-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 58311140 |
| Molecular Formula | C33H50F2N2O5 |
| Molecular Weight | 592.77 g/mol |
| Exact Mass | 592.37 |
| IUPAC Name | N-cyclopropyl-2-[(3R,13R,16S,17R,19S)-3-(4,4-dimethyl-2-oxopentyl)-6,6-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxoacetamide |
| SMILES | CC(C)(C)CC(=O)C[C@H]1CCC(F)(F)CCCCCC[C@@H](C(=O)C(=O)NC2CC2)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C33H50F2N2O5/c1-31(2,3)18-23(38)16-21-13-15-33(34,35)14-9-7-6-8-10-20(28(40)29(41)36-22-11-12-22)17-25(39)27-26-24(32(26,4)5)19-37(27)30(21)42/h20-22,24,26-27H,6-19H2,1-5H3,(H,36,41)/t20-,21-,24+,26+,27-/m1/s1 |
| InChIKey | POWGHEDIYZZOHP-RQWPMFQCSA-N |
| XLogP | 5.67 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|