C24H39NO3 — CID 58311157
(3S,8E,14R,17S,18R,20S)-14-(hydroxymethyl)-3,19,19-trimethyl-1-azatricyclo[15.4.0.018,20]henicos-8-ene-2,16-dione (PubChem CID 58311157) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is (3S,8E,14R,17S,18R,20S)-14-(hydroxymethyl)-3,19,19-trimethyl-1-azatricyclo[15.4.0.018,20]henicos-8-ene-2,16-dione.
| Compound Name | (3S,8E,14R,17S,18R,20S)-14-(hydroxymethyl)-3,19,19-trimethyl-1-azatricyclo[15.4.0.018,20]henicos-8-ene-2,16-dione |
|---|---|
| PubChem CID | 58311157 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | (3S,8E,14R,17S,18R,20S)-14-(hydroxymethyl)-3,19,19-trimethyl-1-azatricyclo[15.4.0.018,20]henicos-8-ene-2,16-dione |
| SMILES | C[C@H]1CCCC/C=C/CCCC[C@@H](CO)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C24H39NO3/c1-17-12-10-8-6-4-5-7-9-11-13-18(16-26)14-20(27)22-21-19(24(21,2)3)15-25(22)23(17)28/h4-5,17-19,21-22,26H,6-16H2,1-3H3/b5-4+/t17-,18+,19-,21-,22+/m0/s1 |
| InChIKey | VJOUJTDXZOBQSV-YLJFWAROSA-N |
| XLogP | 4.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|