C33H49F2NO6 — CID 58311158
tert-butyl 2-[(3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-10,10-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate (PubChem CID 58311158) has the molecular formula C33H49F2NO6 and a molecular weight of 593.75 g/mol. Its IUPAC name is tert-butyl 2-[(3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-10,10-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-10,10-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
|---|---|
| PubChem CID | 58311158 |
| Molecular Formula | C33H49F2NO6 |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.35 |
| IUPAC Name | tert-butyl 2-[(3R,13R,16S,17R,19S)-13-(3-cyclopropyl-2-oxopropanoyl)-10,10-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1CCCCCCC(F)(F)CC[C@@H](C(=O)C(=O)CC2CC2)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C33H49F2NO6/c1-31(2,3)42-26(39)18-22-10-8-6-7-9-14-33(34,35)15-13-21(29(40)25(38)16-20-11-12-20)17-24(37)28-27-23(32(27,4)5)19-36(28)30(22)41/h20-23,27-28H,6-19H2,1-5H3/t21-,22-,23+,27+,28-/m1/s1 |
| InChIKey | NDMXAWANXYBEQV-JELZZTTISA-N |
| XLogP | 6.10 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|