C30H47NO5 — CID 58311172
[2-oxo-1-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]hex-5-enyl] acetate (PubChem CID 58311172) has the molecular formula C30H47NO5 and a molecular weight of 501.71 g/mol. Its IUPAC name is [2-oxo-1-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]hex-5-enyl] acetate.
| Compound Name | [2-oxo-1-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]hex-5-enyl] acetate |
|---|---|
| PubChem CID | 58311172 |
| Molecular Formula | C30H47NO5 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.35 |
| IUPAC Name | [2-oxo-1-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]hex-5-enyl] acetate |
| SMILES | C=CCCC(=O)C(OC(C)=O)[C@@H]1CCCCCCCCC[C@H](C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C30H47NO5/c1-6-7-17-24(33)28(36-21(3)32)22-16-14-12-10-8-9-11-13-15-20(2)29(35)31-19-23-26(30(23,4)5)27(31)25(34)18-22/h6,20,22-23,26-28H,1,7-19H2,2-5H3/t20-,22+,23-,26-,27+,28?/m0/s1 |
| InChIKey | SBEZYNZZKMKWPP-HRBZCUHFSA-N |
| XLogP | 5.67 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|