C32H51NO6 — CID 58311227
tert-butyl 2-[(3R,13R,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-(2-oxopentanoyl)-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate (PubChem CID 58311227) has the molecular formula C32H51NO6 and a molecular weight of 545.76 g/mol. Its IUPAC name is tert-butyl 2-[(3R,13R,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-(2-oxopentanoyl)-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,13R,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-(2-oxopentanoyl)-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
|---|---|
| PubChem CID | 58311227 |
| Molecular Formula | C32H51NO6 |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.37 |
| IUPAC Name | tert-butyl 2-[(3R,13R,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-(2-oxopentanoyl)-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
| SMILES | CCCC(=O)C(=O)[C@@H]1CCCCCCCCC[C@H](CC(=O)OC(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C32H51NO6/c1-7-15-24(34)29(37)21-16-13-11-9-8-10-12-14-17-22(19-26(36)39-31(2,3)4)30(38)33-20-23-27(32(23,5)6)28(33)25(35)18-21/h21-23,27-28H,7-20H2,1-6H3/t21-,22-,23+,27+,28-/m1/s1 |
| InChIKey | GNFJWMRQVGOBNZ-JELZZTTISA-N |
| XLogP | 5.86 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|