C30H47NO7 — CID 58311233
ethyl (3S,4S,7Z,13R,16S,17R,19S)-4,18,18-trimethyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icos-7-ene-13-carboxylate (PubChem CID 58311233) has the molecular formula C30H47NO7 and a molecular weight of 533.71 g/mol. Its IUPAC name is ethyl (3S,4S,7Z,13R,16S,17R,19S)-4,18,18-trimethyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icos-7-ene-13-carboxylate.
| Compound Name | ethyl (3S,4S,7Z,13R,16S,17R,19S)-4,18,18-trimethyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icos-7-ene-13-carboxylate |
|---|---|
| PubChem CID | 58311233 |
| Molecular Formula | C30H47NO7 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.34 |
| IUPAC Name | ethyl (3S,4S,7Z,13R,16S,17R,19S)-4,18,18-trimethyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icos-7-ene-13-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCC/C=C\CO[C@@H](C)[C@H](CC(=O)OC(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C30H47NO7/c1-8-36-28(35)20-14-12-10-9-11-13-15-37-19(2)21(17-24(33)38-29(3,4)5)27(34)31-18-22-25(30(22,6)7)26(31)23(32)16-20/h11,13,19-22,25-26H,8-10,12,14-18H2,1-7H3/b13-11-/t19-,20+,21-,22-,25-,26+/m0/s1 |
| InChIKey | DLYQZJNNYTXKDX-IVIDYEHBSA-N |
| XLogP | 4.49 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|