C24H40N2O4 — CID 58311249
2-hydroxy-2-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]acetamide (PubChem CID 58311249) has the molecular formula C24H40N2O4 and a molecular weight of 420.59 g/mol. Its IUPAC name is 2-hydroxy-2-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]acetamide.
| Compound Name | 2-hydroxy-2-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]acetamide |
|---|---|
| PubChem CID | 58311249 |
| Molecular Formula | C24H40N2O4 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | 2-hydroxy-2-[(3S,13R,16S,17R,19S)-3,18,18-trimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-13-yl]acetamide |
| SMILES | C[C@H]1CCCCCCCCC[C@@H](C(O)C(N)=O)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C24H40N2O4/c1-15-11-9-7-5-4-6-8-10-12-16(21(28)22(25)29)13-18(27)20-19-17(24(19,2)3)14-26(20)23(15)30/h15-17,19-21,28H,4-14H2,1-3H3,(H2,25,29)/t15-,16+,17-,19-,20+,21?/m0/s1 |
| InChIKey | AERQUPAGPVPLTM-PGCOKVOCSA-N |
| XLogP | 3.05 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |