C34H53NO8 — CID 58311251
tert-butyl 2-[(3S,13R,16S,17R,19S)-13-(1-acetyloxy-2-oxohex-5-enyl)-18,18-dimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate (PubChem CID 58311251) has the molecular formula C34H53NO8 and a molecular weight of 603.80 g/mol. Its IUPAC name is tert-butyl 2-[(3S,13R,16S,17R,19S)-13-(1-acetyloxy-2-oxohex-5-enyl)-18,18-dimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S,13R,16S,17R,19S)-13-(1-acetyloxy-2-oxohex-5-enyl)-18,18-dimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
|---|---|
| PubChem CID | 58311251 |
| Molecular Formula | C34H53NO8 |
| Molecular Weight | 603.80 g/mol |
| Exact Mass | 603.38 |
| IUPAC Name | tert-butyl 2-[(3S,13R,16S,17R,19S)-13-(1-acetyloxy-2-oxohex-5-enyl)-18,18-dimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
| SMILES | C=CCCC(=O)C(OC(C)=O)[C@@H]1CCCCCCCOC[C@H](CC(=O)OC(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C34H53NO8/c1-8-9-16-26(37)31(42-22(2)36)23-15-13-11-10-12-14-17-41-21-24(19-28(39)43-33(3,4)5)32(40)35-20-25-29(34(25,6)7)30(35)27(38)18-23/h8,23-25,29-31H,1,9-21H2,2-7H3/t23-,24+,25+,29+,30-,31?/m1/s1 |
| InChIKey | JGYVWKMFRXUWTI-IQXIZNNBSA-N |
| XLogP | 5.23 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.80 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|