C38H60N2O6 — CID 58311262
(3S,13R,16S,17R,19S)-3-[(2S)-3,3-dimethyl-2-[(2-oxopiperidin-1-yl)methyl]butyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione (PubChem CID 58311262) has the molecular formula C38H60N2O6 and a molecular weight of 640.91 g/mol. Its IUPAC name is (3S,13R,16S,17R,19S)-3-[(2S)-3,3-dimethyl-2-[(2-oxopiperidin-1-yl)methyl]butyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione.
| Compound Name | (3S,13R,16S,17R,19S)-3-[(2S)-3,3-dimethyl-2-[(2-oxopiperidin-1-yl)methyl]butyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
|---|---|
| PubChem CID | 58311262 |
| Molecular Formula | C38H60N2O6 |
| Molecular Weight | 640.91 g/mol |
| Exact Mass | 640.45 |
| IUPAC Name | (3S,13R,16S,17R,19S)-3-[(2S)-3,3-dimethyl-2-[(2-oxopiperidin-1-yl)methyl]butyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
| SMILES | C=CCCC(=O)C(=O)[C@@H]1CCCCCCCOC[C@H](C[C@H](CN2CCCCC2=O)C(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C38H60N2O6/c1-7-8-17-30(41)35(44)26-16-12-10-9-11-15-20-46-25-27(21-28(37(2,3)4)23-39-19-14-13-18-32(39)43)36(45)40-24-29-33(38(29,5)6)34(40)31(42)22-26/h7,26-29,33-34H,1,8-25H2,2-6H3/t26-,27+,28-,29+,33+,34-/m1/s1 |
| InChIKey | TXTFABNNEKZPQD-PGGXUSSMSA-N |
| XLogP | 6.20 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.91 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|