C28H45NO4 — CID 58311291
(3S,13R,16S,17R,19S)-13-(1-hydroxy-2-oxohex-5-enyl)-3,18,18-trimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione (PubChem CID 58311291) has the molecular formula C28H45NO4 and a molecular weight of 459.67 g/mol. Its IUPAC name is (3S,13R,16S,17R,19S)-13-(1-hydroxy-2-oxohex-5-enyl)-3,18,18-trimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione.
| Compound Name | (3S,13R,16S,17R,19S)-13-(1-hydroxy-2-oxohex-5-enyl)-3,18,18-trimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
|---|---|
| PubChem CID | 58311291 |
| Molecular Formula | C28H45NO4 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | (3S,13R,16S,17R,19S)-13-(1-hydroxy-2-oxohex-5-enyl)-3,18,18-trimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
| SMILES | C=CCCC(=O)C(O)[C@@H]1CCCCCCCCC[C@H](C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C28H45NO4/c1-5-6-16-22(30)26(32)20-15-13-11-9-7-8-10-12-14-19(2)27(33)29-18-21-24(28(21,3)4)25(29)23(31)17-20/h5,19-21,24-26,32H,1,6-18H2,2-4H3/t19-,20+,21-,24-,25+,26?/m0/s1 |
| InChIKey | ZQPCDFGNSUUNQA-LLDBLTNMSA-N |
| XLogP | 5.10 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|