C28H41NO6 — CID 58311323
2-[(3S,13R,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetaldehyde (PubChem CID 58311323) has the molecular formula C28H41NO6 and a molecular weight of 487.64 g/mol. Its IUPAC name is 2-[(3S,13R,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetaldehyde.
| Compound Name | 2-[(3S,13R,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 58311323 |
| Molecular Formula | C28H41NO6 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 2-[(3S,13R,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetaldehyde |
| SMILES | C=CCCC(=O)C(=O)[C@@H]1CCCCCCCOC[C@H](CC=O)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C28H41NO6/c1-4-5-12-22(31)26(33)19-11-9-7-6-8-10-15-35-18-20(13-14-30)27(34)29-17-21-24(28(21,2)3)25(29)23(32)16-19/h4,14,19-21,24-25H,1,5-13,15-18H2,2-3H3/t19-,20+,21+,24+,25-/m1/s1 |
| InChIKey | VSRHHCUCMGHFGC-GHOMIUGCSA-N |
| XLogP | 3.73 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|