C40H59NO7 — CID 58311334
(3S,13R,16S,17R,19S)-3-[(4S)-4-cyclohexyl-5-cyclopropyl-2,5-dioxopentyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione (PubChem CID 58311334) has the molecular formula C40H59NO7 and a molecular weight of 665.91 g/mol. Its IUPAC name is (3S,13R,16S,17R,19S)-3-[(4S)-4-cyclohexyl-5-cyclopropyl-2,5-dioxopentyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione.
| Compound Name | (3S,13R,16S,17R,19S)-3-[(4S)-4-cyclohexyl-5-cyclopropyl-2,5-dioxopentyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
|---|---|
| PubChem CID | 58311334 |
| Molecular Formula | C40H59NO7 |
| Molecular Weight | 665.91 g/mol |
| Exact Mass | 665.43 |
| IUPAC Name | (3S,13R,16S,17R,19S)-3-[(4S)-4-cyclohexyl-5-cyclopropyl-2,5-dioxopentyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
| SMILES | C=CCCC(=O)C(=O)[C@@H]1CCCCCCCOC[C@H](CC(=O)C[C@H](C(=O)C2CC2)C2CCCCC2)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C40H59NO7/c1-4-5-17-33(43)38(46)28-16-10-7-6-8-13-20-48-25-29(39(47)41-24-32-35(40(32,2)3)36(41)34(44)22-28)21-30(42)23-31(37(45)27-18-19-27)26-14-11-9-12-15-26/h4,26-29,31-32,35-36H,1,5-25H2,2-3H3/t28-,29+,31+,32+,35+,36-/m1/s1 |
| InChIKey | XPSNHOCJDCUEOJ-HGXOBLRKSA-N |
| XLogP | 6.66 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.91 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|