C30H48N2O6 — CID 58311380
tert-butyl 2-[(3R,14R,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-3-yl]acetate (PubChem CID 58311380) has the molecular formula C30H48N2O6 and a molecular weight of 532.72 g/mol. Its IUPAC name is tert-butyl 2-[(3R,14R,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,14R,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-3-yl]acetate |
|---|---|
| PubChem CID | 58311380 |
| Molecular Formula | C30H48N2O6 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | tert-butyl 2-[(3R,14R,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1CCCCCCCCCC[C@@H](C(=O)C(N)=O)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C30H48N2O6/c1-29(2,3)38-23(34)17-20-15-13-11-9-7-6-8-10-12-14-19(26(35)27(31)36)16-22(33)25-24-21(30(24,4)5)18-32(25)28(20)37/h19-21,24-25H,6-18H2,1-5H3,(H2,31,36)/t19-,20-,21+,24+,25-/m1/s1 |
| InChIKey | BERACANUUDMKLR-XIKCKBGFSA-N |
| XLogP | 4.36 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|