C26H41NO5 — CID 58311389
methyl (3S,8E,14R,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-ene-14-carboxylate (PubChem CID 58311389) has the molecular formula C26H41NO5 and a molecular weight of 447.62 g/mol. Its IUPAC name is methyl (3S,8E,14R,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-ene-14-carboxylate.
| Compound Name | methyl (3S,8E,14R,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-ene-14-carboxylate |
|---|---|
| PubChem CID | 58311389 |
| Molecular Formula | C26H41NO5 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | methyl (3S,8E,14R,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-ene-14-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCC/C=C/CCCC[C@H](C)C(=O)N2CC3OC(C)(C)C[C@@H]3C2C(=O)C1 |
| InChI | InChI=1S/C26H41NO5/c1-18-13-11-9-7-5-6-8-10-12-14-19(25(30)31-4)15-21(28)23-20-16-26(2,3)32-22(20)17-27(23)24(18)29/h5-6,18-20,22-23H,7-17H2,1-4H3/b6-5+/t18-,19+,20-,22?,23?/m0/s1 |
| InChIKey | YVRGXGQUIXRGNN-WNDWHTHXSA-N |
| XLogP | 4.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|