C19H31NO4 — CID 58311456
methyl (3aR,4S)-2,2-dimethyl-5-(2-methyloct-7-enoyl)-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxylate (PubChem CID 58311456) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is methyl (3aR,4S)-2,2-dimethyl-5-(2-methyloct-7-enoyl)-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxylate.
| Compound Name | methyl (3aR,4S)-2,2-dimethyl-5-(2-methyloct-7-enoyl)-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 58311456 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | methyl (3aR,4S)-2,2-dimethyl-5-(2-methyloct-7-enoyl)-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxylate |
| SMILES | C=CCCCCC(C)C(=O)N1CC2OC(C)(C)C[C@@H]2[C@H]1C(=O)OC |
| InChI | InChI=1S/C19H31NO4/c1-6-7-8-9-10-13(2)17(21)20-12-15-14(11-19(3,4)24-15)16(20)18(22)23-5/h6,13-16H,1,7-12H2,2-5H3/t13?,14-,15?,16-/m0/s1 |
| InChIKey | GSWVXBNWNOFBCM-GRAKBVBRSA-N |
| XLogP | 2.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|