C28H47NO6 — CID 58311468
tert-butyl 2-[(3S,4S,13R,16S,17R,19S)-13-(hydroxymethyl)-4,18,18-trimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate (PubChem CID 58311468) has the molecular formula C28H47NO6 and a molecular weight of 493.69 g/mol. Its IUPAC name is tert-butyl 2-[(3S,4S,13R,16S,17R,19S)-13-(hydroxymethyl)-4,18,18-trimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S,4S,13R,16S,17R,19S)-13-(hydroxymethyl)-4,18,18-trimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
|---|---|
| PubChem CID | 58311468 |
| Molecular Formula | C28H47NO6 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.34 |
| IUPAC Name | tert-butyl 2-[(3S,4S,13R,16S,17R,19S)-13-(hydroxymethyl)-4,18,18-trimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
| SMILES | C[C@@H]1OCCCCCCC[C@@H](CO)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C(=O)[C@H]1CC(=O)OC(C)(C)C)C3(C)C |
| InChI | InChI=1S/C28H47NO6/c1-18-20(15-23(32)35-27(2,3)4)26(33)29-16-21-24(28(21,5)6)25(29)22(31)14-19(17-30)12-10-8-7-9-11-13-34-18/h18-21,24-25,30H,7-17H2,1-6H3/t18-,19+,20-,21-,24-,25+/m0/s1 |
| InChIKey | MHFKVUQQKSZUBY-GGYSQDOYSA-N |
| XLogP | 4.14 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |