C32H48F2N2O6 — CID 58311472
tert-butyl 2-[(3R,13R,16S,17R,19S)-13-[2-(cyclopropylamino)-2-oxoacetyl]-6,6-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate (PubChem CID 58311472) has the molecular formula C32H48F2N2O6 and a molecular weight of 594.74 g/mol. Its IUPAC name is tert-butyl 2-[(3R,13R,16S,17R,19S)-13-[2-(cyclopropylamino)-2-oxoacetyl]-6,6-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,13R,16S,17R,19S)-13-[2-(cyclopropylamino)-2-oxoacetyl]-6,6-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
|---|---|
| PubChem CID | 58311472 |
| Molecular Formula | C32H48F2N2O6 |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | tert-butyl 2-[(3R,13R,16S,17R,19S)-13-[2-(cyclopropylamino)-2-oxoacetyl]-6,6-difluoro-18,18-dimethyl-2,15-dioxo-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1CCC(F)(F)CCCCCC[C@@H](C(=O)C(=O)NC2CC2)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C32H48F2N2O6/c1-30(2,3)42-24(38)17-20-13-15-32(33,34)14-9-7-6-8-10-19(27(39)28(40)35-21-11-12-21)16-23(37)26-25-22(31(25,4)5)18-36(26)29(20)41/h19-22,25-26H,6-18H2,1-5H3,(H,35,40)/t19-,20-,22+,25+,26-/m1/s1 |
| InChIKey | ZVWZZWUPPRVODI-TZOSFIHFSA-N |
| XLogP | 5.01 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|