C25H19F6N5O2S — CID 58311540
(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(5-oxo-1,4-diazepan-1-yl)-1,3-thiazol-4-one (PubChem CID 58311540) has the molecular formula C25H19F6N5O2S and a molecular weight of 567.52 g/mol. Its IUPAC name is (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(5-oxo-1,4-diazepan-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(5-oxo-1,4-diazepan-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311540 |
| Molecular Formula | C25H19F6N5O2S |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(5-oxo-1,4-diazepan-1-yl)-1,3-thiazol-4-one |
| SMILES | O=C1CCN(C2=NC(=O)/C(=C/c3ccc4c(cnn4Cc4ccc(C(F)(F)F)cc4C(F)(F)F)c3)S2)CCN1 |
| InChI | InChI=1S/C25H19F6N5O2S/c26-24(27,28)17-3-2-15(18(11-17)25(29,30)31)13-36-19-4-1-14(9-16(19)12-33-36)10-20-22(38)34-23(39-20)35-7-5-21(37)32-6-8-35/h1-4,9-12H,5-8,13H2,(H,32,37)/b20-10- |
| InChIKey | KBFXKIVODSKMNE-JMIUGGIZSA-N |
| XLogP | 4.91 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|